C22H32BrN3O — CID 70412963
1-phenyl-3-[2-[4-phenylbutyl(propyl)amino]ethyl]urea;hydrobromide (PubChem CID 70412963) has the molecular formula C22H32BrN3O and a molecular weight of 434.42 g/mol. Its IUPAC name is 1-phenyl-3-[2-[4-phenylbutyl(propyl)amino]ethyl]urea;hydrobromide.
| Compound Name | 1-phenyl-3-[2-[4-phenylbutyl(propyl)amino]ethyl]urea;hydrobromide |
|---|---|
| PubChem CID | 70412963 |
| Molecular Formula | C22H32BrN3O |
| Molecular Weight | 434.42 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 1-phenyl-3-[2-[4-phenylbutyl(propyl)amino]ethyl]urea;hydrobromide |
| SMILES | Br.CCCN(CCCCc1ccccc1)CCNC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C22H31N3O.BrH/c1-2-17-25(18-10-9-13-20-11-5-3-6-12-20)19-16-23-22(26)24-21-14-7-4-8-15-21;/h3-8,11-12,14-15H,2,9-10,13,16-19H2,1H3,(H2,23,24,26);1H |
| InChIKey | GKMZCTLIMZYFRN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.42 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|