C47H82N6O2 — CID 139954807
1-[2-[hexyl(octyl)amino]ethyl]-3-[3-[[3-[2-[hexyl(octyl)amino]ethylcarbamoylamino]phenyl]methyl]phenyl]urea (PubChem CID 139954807) has the molecular formula C47H82N6O2 and a molecular weight of 763.21 g/mol. Its IUPAC name is 1-[2-[hexyl(octyl)amino]ethyl]-3-[3-[[3-[2-[hexyl(octyl)amino]ethylcarbamoylamino]phenyl]methyl]phenyl]urea.
| Compound Name | 1-[2-[hexyl(octyl)amino]ethyl]-3-[3-[[3-[2-[hexyl(octyl)amino]ethylcarbamoylamino]phenyl]methyl]phenyl]urea |
|---|---|
| PubChem CID | 139954807 |
| Molecular Formula | C47H82N6O2 |
| Molecular Weight | 763.21 g/mol |
| Exact Mass | 762.65 |
| IUPAC Name | 1-[2-[hexyl(octyl)amino]ethyl]-3-[3-[[3-[2-[hexyl(octyl)amino]ethylcarbamoylamino]phenyl]methyl]phenyl]urea |
| SMILES | CCCCCCCCN(CCCCCC)CCNC(=O)Nc1cccc(Cc2cccc(NC(=O)NCCN(CCCCCC)CCCCCCCC)c2)c1 |
| InChI | InChI=1S/C47H82N6O2/c1-5-9-13-17-19-23-35-52(33-21-15-11-7-3)37-31-48-46(54)50-44-29-25-27-42(40-44)39-43-28-26-30-45(41-43)51-47(55)49-32-38-53(34-22-16-12-8-4)36-24-20-18-14-10-6-2/h25-30,40-41H,5-24,31-39H2,1-4H3,(H2,48,50,54)(H2,49,51,55) |
| InChIKey | PSMLZEXVZWEPGW-UHFFFAOYSA-N |
| XLogP | 12.01 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.21 |
| LogP ≤ 5 | 12.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|