C51H90N6O2 — CID 139955455
1-[2-(dioctylamino)ethyl]-3-[3-[[3-[2-(dioctylamino)ethylcarbamoylamino]phenyl]methyl]phenyl]urea (PubChem CID 139955455) has the molecular formula C51H90N6O2 and a molecular weight of 819.32 g/mol. Its IUPAC name is 1-[2-(dioctylamino)ethyl]-3-[3-[[3-[2-(dioctylamino)ethylcarbamoylamino]phenyl]methyl]phenyl]urea.
| Compound Name | 1-[2-(dioctylamino)ethyl]-3-[3-[[3-[2-(dioctylamino)ethylcarbamoylamino]phenyl]methyl]phenyl]urea |
|---|---|
| PubChem CID | 139955455 |
| Molecular Formula | C51H90N6O2 |
| Molecular Weight | 819.32 g/mol |
| Exact Mass | 818.71 |
| IUPAC Name | 1-[2-(dioctylamino)ethyl]-3-[3-[[3-[2-(dioctylamino)ethylcarbamoylamino]phenyl]methyl]phenyl]urea |
| SMILES | CCCCCCCCN(CCCCCCCC)CCNC(=O)Nc1cccc(Cc2cccc(NC(=O)NCCN(CCCCCCCC)CCCCCCCC)c2)c1 |
| InChI | InChI=1S/C51H90N6O2/c1-5-9-13-17-21-25-37-56(38-26-22-18-14-10-6-2)41-35-52-50(58)54-48-33-29-31-46(44-48)43-47-32-30-34-49(45-47)55-51(59)53-36-42-57(39-27-23-19-15-11-7-3)40-28-24-20-16-12-8-4/h29-34,44-45H,5-28,35-43H2,1-4H3,(H2,52,54,58)(H2,53,55,59) |
| InChIKey | SIIIWKRKDQPYID-UHFFFAOYSA-N |
| XLogP | 13.57 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.32 |
| LogP ≤ 5 | 13.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|