C43H72N4O2 — CID 139954936
3-[heptyl(pentyl)amino]-N-[3-[[3-[3-[heptyl(pentyl)amino]propanoylamino]phenyl]methyl]phenyl]propanamide (PubChem CID 139954936) has the molecular formula C43H72N4O2 and a molecular weight of 677.08 g/mol. Its IUPAC name is 3-[heptyl(pentyl)amino]-N-[3-[[3-[3-[heptyl(pentyl)amino]propanoylamino]phenyl]methyl]phenyl]propanamide.
| Compound Name | 3-[heptyl(pentyl)amino]-N-[3-[[3-[3-[heptyl(pentyl)amino]propanoylamino]phenyl]methyl]phenyl]propanamide |
|---|---|
| PubChem CID | 139954936 |
| Molecular Formula | C43H72N4O2 |
| Molecular Weight | 677.08 g/mol |
| Exact Mass | 676.57 |
| IUPAC Name | 3-[heptyl(pentyl)amino]-N-[3-[[3-[3-[heptyl(pentyl)amino]propanoylamino]phenyl]methyl]phenyl]propanamide |
| SMILES | CCCCCCCN(CCCCC)CCC(=O)Nc1cccc(Cc2cccc(NC(=O)CCN(CCCCC)CCCCCCC)c2)c1 |
| InChI | InChI=1S/C43H72N4O2/c1-5-9-13-15-19-31-46(29-17-11-7-3)33-27-42(48)44-40-25-21-23-38(36-40)35-39-24-22-26-41(37-39)45-43(49)28-34-47(30-18-12-8-4)32-20-16-14-10-6-2/h21-26,36-37H,5-20,27-35H2,1-4H3,(H,44,48)(H,45,49) |
| InChIKey | YRZBJRVGXMFGIN-UHFFFAOYSA-N |
| XLogP | 10.86 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.08 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|