C25H34N2O2 — CID 101187552
N-[3-[[3-(hexanoylamino)phenyl]methyl]phenyl]hexanamide (PubChem CID 101187552) has the molecular formula C25H34N2O2 and a molecular weight of 394.56 g/mol. Its IUPAC name is N-[3-[[3-(hexanoylamino)phenyl]methyl]phenyl]hexanamide.
| Compound Name | N-[3-[[3-(hexanoylamino)phenyl]methyl]phenyl]hexanamide |
|---|---|
| PubChem CID | 101187552 |
| Molecular Formula | C25H34N2O2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | N-[3-[[3-(hexanoylamino)phenyl]methyl]phenyl]hexanamide |
| SMILES | CCCCCC(=O)Nc1cccc(Cc2cccc(NC(=O)CCCCC)c2)c1 |
| InChI | InChI=1S/C25H34N2O2/c1-3-5-7-15-24(28)26-22-13-9-11-20(18-22)17-21-12-10-14-23(19-21)27-25(29)16-8-6-4-2/h9-14,18-19H,3-8,15-17H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | UANKQLKWPYNDOP-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|