C41H68N4O2 — CID 139955530
3-[butyl(heptyl)amino]-N-[4-[[4-[3-[butyl(heptyl)amino]propanoylamino]phenyl]methyl]phenyl]propanamide (PubChem CID 139955530) has the molecular formula C41H68N4O2 and a molecular weight of 649.02 g/mol. Its IUPAC name is 3-[butyl(heptyl)amino]-N-[4-[[4-[3-[butyl(heptyl)amino]propanoylamino]phenyl]methyl]phenyl]propanamide.
| Compound Name | 3-[butyl(heptyl)amino]-N-[4-[[4-[3-[butyl(heptyl)amino]propanoylamino]phenyl]methyl]phenyl]propanamide |
|---|---|
| PubChem CID | 139955530 |
| Molecular Formula | C41H68N4O2 |
| Molecular Weight | 649.02 g/mol |
| Exact Mass | 648.53 |
| IUPAC Name | 3-[butyl(heptyl)amino]-N-[4-[[4-[3-[butyl(heptyl)amino]propanoylamino]phenyl]methyl]phenyl]propanamide |
| SMILES | CCCCCCCN(CCCC)CCC(=O)Nc1ccc(Cc2ccc(NC(=O)CCN(CCCC)CCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C41H68N4O2/c1-5-9-13-15-17-31-44(29-11-7-3)33-27-40(46)42-38-23-19-36(20-24-38)35-37-21-25-39(26-22-37)43-41(47)28-34-45(30-12-8-4)32-18-16-14-10-6-2/h19-26H,5-18,27-35H2,1-4H3,(H,42,46)(H,43,47) |
| InChIKey | PODBQDDFDLUOOG-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.02 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|