C41H70N6O2 — CID 139955043
1-[[butyl(octyl)amino]methyl]-3-[4-[[4-[[butyl(octyl)amino]methylcarbamoylamino]phenyl]methyl]phenyl]urea (PubChem CID 139955043) has the molecular formula C41H70N6O2 and a molecular weight of 679.05 g/mol. Its IUPAC name is 1-[[butyl(octyl)amino]methyl]-3-[4-[[4-[[butyl(octyl)amino]methylcarbamoylamino]phenyl]methyl]phenyl]urea.
| Compound Name | 1-[[butyl(octyl)amino]methyl]-3-[4-[[4-[[butyl(octyl)amino]methylcarbamoylamino]phenyl]methyl]phenyl]urea |
|---|---|
| PubChem CID | 139955043 |
| Molecular Formula | C41H70N6O2 |
| Molecular Weight | 679.05 g/mol |
| Exact Mass | 678.56 |
| IUPAC Name | 1-[[butyl(octyl)amino]methyl]-3-[4-[[4-[[butyl(octyl)amino]methylcarbamoylamino]phenyl]methyl]phenyl]urea |
| SMILES | CCCCCCCCN(CCCC)CNC(=O)Nc1ccc(Cc2ccc(NC(=O)NCN(CCCC)CCCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C41H70N6O2/c1-5-9-13-15-17-19-31-46(29-11-7-3)34-42-40(48)44-38-25-21-36(22-26-38)33-37-23-27-39(28-24-37)45-41(49)43-35-47(30-12-8-4)32-20-18-16-14-10-6-2/h21-28H,5-20,29-35H2,1-4H3,(H2,42,44,48)(H2,43,45,49) |
| InChIKey | NUZJBDDBFRZKIJ-UHFFFAOYSA-N |
| XLogP | 10.36 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.05 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|