C20H25N3O3 — CID 69144351
[4-[[4-(pentylcarbamoylamino)phenyl]methyl]phenyl]carbamic acid (PubChem CID 69144351) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is [4-[[4-(pentylcarbamoylamino)phenyl]methyl]phenyl]carbamic acid.
| Compound Name | [4-[[4-(pentylcarbamoylamino)phenyl]methyl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 69144351 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | [4-[[4-(pentylcarbamoylamino)phenyl]methyl]phenyl]carbamic acid |
| SMILES | CCCCCNC(=O)Nc1ccc(Cc2ccc(NC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C20H25N3O3/c1-2-3-4-13-21-19(24)22-17-9-5-15(6-10-17)14-16-7-11-18(12-8-16)23-20(25)26/h5-12,23H,2-4,13-14H2,1H3,(H,25,26)(H2,21,22,24) |
| InChIKey | WYLIBTQVQKQIMS-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|