C37H62N6O2 — CID 139955906
1-[4-[hexyl(methyl)amino]butyl]-3-[4-[[4-[4-[hexyl(methyl)amino]butylcarbamoylamino]phenyl]methyl]phenyl]urea (PubChem CID 139955906) has the molecular formula C37H62N6O2 and a molecular weight of 622.94 g/mol. Its IUPAC name is 1-[4-[hexyl(methyl)amino]butyl]-3-[4-[[4-[4-[hexyl(methyl)amino]butylcarbamoylamino]phenyl]methyl]phenyl]urea.
| Compound Name | 1-[4-[hexyl(methyl)amino]butyl]-3-[4-[[4-[4-[hexyl(methyl)amino]butylcarbamoylamino]phenyl]methyl]phenyl]urea |
|---|---|
| PubChem CID | 139955906 |
| Molecular Formula | C37H62N6O2 |
| Molecular Weight | 622.94 g/mol |
| Exact Mass | 622.49 |
| IUPAC Name | 1-[4-[hexyl(methyl)amino]butyl]-3-[4-[[4-[4-[hexyl(methyl)amino]butylcarbamoylamino]phenyl]methyl]phenyl]urea |
| SMILES | CCCCCCN(C)CCCCNC(=O)Nc1ccc(Cc2ccc(NC(=O)NCCCCN(C)CCCCCC)cc2)cc1 |
| InChI | InChI=1S/C37H62N6O2/c1-5-7-9-13-27-42(3)29-15-11-25-38-36(44)40-34-21-17-32(18-22-34)31-33-19-23-35(24-20-33)41-37(45)39-26-12-16-30-43(4)28-14-10-8-6-2/h17-24H,5-16,25-31H2,1-4H3,(H2,38,40,44)(H2,39,41,45) |
| InChIKey | LEZXYEMAHQEDLZ-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.94 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|