C35H58N6O2 — CID 139954392
1-[2-[heptyl(methyl)amino]ethyl]-3-[3-[[3-[2-[heptyl(methyl)amino]ethylcarbamoylamino]phenyl]methyl]phenyl]urea (PubChem CID 139954392) has the molecular formula C35H58N6O2 and a molecular weight of 594.89 g/mol. Its IUPAC name is 1-[2-[heptyl(methyl)amino]ethyl]-3-[3-[[3-[2-[heptyl(methyl)amino]ethylcarbamoylamino]phenyl]methyl]phenyl]urea.
| Compound Name | 1-[2-[heptyl(methyl)amino]ethyl]-3-[3-[[3-[2-[heptyl(methyl)amino]ethylcarbamoylamino]phenyl]methyl]phenyl]urea |
|---|---|
| PubChem CID | 139954392 |
| Molecular Formula | C35H58N6O2 |
| Molecular Weight | 594.89 g/mol |
| Exact Mass | 594.46 |
| IUPAC Name | 1-[2-[heptyl(methyl)amino]ethyl]-3-[3-[[3-[2-[heptyl(methyl)amino]ethylcarbamoylamino]phenyl]methyl]phenyl]urea |
| SMILES | CCCCCCCN(C)CCNC(=O)Nc1cccc(Cc2cccc(NC(=O)NCCN(C)CCCCCCC)c2)c1 |
| InChI | InChI=1S/C35H58N6O2/c1-5-7-9-11-13-23-40(3)25-21-36-34(42)38-32-19-15-17-30(28-32)27-31-18-16-20-33(29-31)39-35(43)37-22-26-41(4)24-14-12-10-8-6-2/h15-20,28-29H,5-14,21-27H2,1-4H3,(H2,36,38,42)(H2,37,39,43) |
| InChIKey | UIZQIKYCYTWAJF-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.89 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|