C39H66N6O2 — CID 139954193
1-[3-[butyl(pentyl)amino]propyl]-3-[3-[[3-[3-[butyl(pentyl)amino]propylcarbamoylamino]phenyl]methyl]phenyl]urea (PubChem CID 139954193) has the molecular formula C39H66N6O2 and a molecular weight of 651.00 g/mol. Its IUPAC name is 1-[3-[butyl(pentyl)amino]propyl]-3-[3-[[3-[3-[butyl(pentyl)amino]propylcarbamoylamino]phenyl]methyl]phenyl]urea.
| Compound Name | 1-[3-[butyl(pentyl)amino]propyl]-3-[3-[[3-[3-[butyl(pentyl)amino]propylcarbamoylamino]phenyl]methyl]phenyl]urea |
|---|---|
| PubChem CID | 139954193 |
| Molecular Formula | C39H66N6O2 |
| Molecular Weight | 651.00 g/mol |
| Exact Mass | 650.52 |
| IUPAC Name | 1-[3-[butyl(pentyl)amino]propyl]-3-[3-[[3-[3-[butyl(pentyl)amino]propylcarbamoylamino]phenyl]methyl]phenyl]urea |
| SMILES | CCCCCN(CCCC)CCCNC(=O)Nc1cccc(Cc2cccc(NC(=O)NCCCN(CCCC)CCCCC)c2)c1 |
| InChI | InChI=1S/C39H66N6O2/c1-5-9-13-27-44(25-11-7-3)29-17-23-40-38(46)42-36-21-15-19-34(32-36)31-35-20-16-22-37(33-35)43-39(47)41-24-18-30-45(26-12-8-4)28-14-10-6-2/h15-16,19-22,32-33H,5-14,17-18,23-31H2,1-4H3,(H2,40,42,46)(H2,41,43,47) |
| InChIKey | XJLQWTWUDPDPKM-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.00 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|