C26H38N4O2 — CID 71078956
N-[4-[[4-[2-(dibutylamino)ethylcarbamoylamino]phenyl]methyl]phenyl]acetamide (PubChem CID 71078956) has the molecular formula C26H38N4O2 and a molecular weight of 438.62 g/mol. Its IUPAC name is N-[4-[[4-[2-(dibutylamino)ethylcarbamoylamino]phenyl]methyl]phenyl]acetamide.
| Compound Name | N-[4-[[4-[2-(dibutylamino)ethylcarbamoylamino]phenyl]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 71078956 |
| Molecular Formula | C26H38N4O2 |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | N-[4-[[4-[2-(dibutylamino)ethylcarbamoylamino]phenyl]methyl]phenyl]acetamide |
| SMILES | CCCCN(CCCC)CCNC(=O)Nc1ccc(Cc2ccc(NC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C26H38N4O2/c1-4-6-17-30(18-7-5-2)19-16-27-26(32)29-25-14-10-23(11-15-25)20-22-8-12-24(13-9-22)28-21(3)31/h8-15H,4-7,16-20H2,1-3H3,(H,28,31)(H2,27,29,32) |
| InChIKey | FJQDVFCRXFGOOA-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |