C27H42N6O2 — CID 139956196
1-[4-(dimethylamino)butyl]-3-[4-[[4-[4-(dimethylamino)butylcarbamoylamino]phenyl]methyl]phenyl]urea (PubChem CID 139956196) has the molecular formula C27H42N6O2 and a molecular weight of 482.67 g/mol. Its IUPAC name is 1-[4-(dimethylamino)butyl]-3-[4-[[4-[4-(dimethylamino)butylcarbamoylamino]phenyl]methyl]phenyl]urea.
| Compound Name | 1-[4-(dimethylamino)butyl]-3-[4-[[4-[4-(dimethylamino)butylcarbamoylamino]phenyl]methyl]phenyl]urea |
|---|---|
| PubChem CID | 139956196 |
| Molecular Formula | C27H42N6O2 |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.34 |
| IUPAC Name | 1-[4-(dimethylamino)butyl]-3-[4-[[4-[4-(dimethylamino)butylcarbamoylamino]phenyl]methyl]phenyl]urea |
| SMILES | CN(C)CCCCNC(=O)Nc1ccc(Cc2ccc(NC(=O)NCCCCN(C)C)cc2)cc1 |
| InChI | InChI=1S/C27H42N6O2/c1-32(2)19-7-5-17-28-26(34)30-24-13-9-22(10-14-24)21-23-11-15-25(16-12-23)31-27(35)29-18-6-8-20-33(3)4/h9-16H,5-8,17-21H2,1-4H3,(H2,28,30,34)(H2,29,31,35) |
| InChIKey | QAHPTOSYTWJUFH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|