C13H21N3O — CID 47103513
1-[3-(dimethylamino)propyl]-3-(4-methylphenyl)urea (PubChem CID 47103513) has the molecular formula C13H21N3O and a molecular weight of 235.33 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-3-(4-methylphenyl)urea.
| Compound Name | 1-[3-(dimethylamino)propyl]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 47103513 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)NCCCN(C)C)cc1 |
| InChI | InChI=1S/C13H21N3O/c1-11-5-7-12(8-6-11)15-13(17)14-9-4-10-16(2)3/h5-8H,4,9-10H2,1-3H3,(H2,14,15,17) |
| InChIKey | VWEIIRRZLOQNGV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|