C12H20ClN3O — CID 163284843
1-(4-aminobutyl)-3-(4-methylphenyl)urea;hydrochloride (PubChem CID 163284843) has the molecular formula C12H20ClN3O and a molecular weight of 257.76 g/mol. Its IUPAC name is 1-(4-aminobutyl)-3-(4-methylphenyl)urea;hydrochloride.
| Compound Name | 1-(4-aminobutyl)-3-(4-methylphenyl)urea;hydrochloride |
|---|---|
| PubChem CID | 163284843 |
| Molecular Formula | C12H20ClN3O |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 1-(4-aminobutyl)-3-(4-methylphenyl)urea;hydrochloride |
| SMILES | Cc1ccc(NC(=O)NCCCCN)cc1.Cl |
| InChI | InChI=1S/C12H19N3O.ClH/c1-10-4-6-11(7-5-10)15-12(16)14-9-3-2-8-13;/h4-7H,2-3,8-9,13H2,1H3,(H2,14,15,16);1H |
| InChIKey | NTDVJYASBUGDHL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|