C25H26F2N2O — CID 159537469
1-[5,5-bis(4-fluorophenyl)pentyl]-3-(4-methylphenyl)urea (PubChem CID 159537469) has the molecular formula C25H26F2N2O and a molecular weight of 408.49 g/mol. Its IUPAC name is 1-[5,5-bis(4-fluorophenyl)pentyl]-3-(4-methylphenyl)urea.
| Compound Name | 1-[5,5-bis(4-fluorophenyl)pentyl]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 159537469 |
| Molecular Formula | C25H26F2N2O |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 1-[5,5-bis(4-fluorophenyl)pentyl]-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)NCCCCC(c2ccc(F)cc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C25H26F2N2O/c1-18-5-15-23(16-6-18)29-25(30)28-17-3-2-4-24(19-7-11-21(26)12-8-19)20-9-13-22(27)14-10-20/h5-16,24H,2-4,17H2,1H3,(H2,28,29,30) |
| InChIKey | ICCCPKNQVQMYTB-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|