C30H32F2N2O2 — CID 11554953
N-[(E)-4-[6,6-bis(4-fluorophenyl)hexanoylamino]but-2-enyl]-4-methylbenzamide (PubChem CID 11554953) has the molecular formula C30H32F2N2O2 and a molecular weight of 490.59 g/mol. Its IUPAC name is N-[(E)-4-[6,6-bis(4-fluorophenyl)hexanoylamino]but-2-enyl]-4-methylbenzamide.
| Compound Name | N-[(E)-4-[6,6-bis(4-fluorophenyl)hexanoylamino]but-2-enyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 11554953 |
| Molecular Formula | C30H32F2N2O2 |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | N-[(E)-4-[6,6-bis(4-fluorophenyl)hexanoylamino]but-2-enyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC/C=C/CNC(=O)CCCCC(c2ccc(F)cc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C30H32F2N2O2/c1-22-8-10-25(11-9-22)30(36)34-21-5-4-20-33-29(35)7-3-2-6-28(23-12-16-26(31)17-13-23)24-14-18-27(32)19-15-24/h4-5,8-19,28H,2-3,6-7,20-21H2,1H3,(H,33,35)(H,34,36)/b5-4+ |
| InChIKey | XMKFVRIONXZIMJ-SNAWJCMRSA-N |
| XLogP | 6.07 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|