C33H33F7N2O2 — CID 123561432
N-[[1-[6-(4-fluorophenyl)-6-(4-methylphenyl)hexanoyl]pyrrolidin-3-yl]methyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 123561432) has the molecular formula C33H33F7N2O2 and a molecular weight of 622.63 g/mol. Its IUPAC name is N-[[1-[6-(4-fluorophenyl)-6-(4-methylphenyl)hexanoyl]pyrrolidin-3-yl]methyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[[1-[6-(4-fluorophenyl)-6-(4-methylphenyl)hexanoyl]pyrrolidin-3-yl]methyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 123561432 |
| Molecular Formula | C33H33F7N2O2 |
| Molecular Weight | 622.63 g/mol |
| Exact Mass | 622.24 |
| IUPAC Name | N-[[1-[6-(4-fluorophenyl)-6-(4-methylphenyl)hexanoyl]pyrrolidin-3-yl]methyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | Cc1ccc(C(CCCCC(=O)N2CCC(CNC(=O)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)C2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C33H33F7N2O2/c1-21-6-8-23(9-7-21)29(24-10-12-28(34)13-11-24)4-2-3-5-30(43)42-15-14-22(20-42)19-41-31(44)25-16-26(32(35,36)37)18-27(17-25)33(38,39)40/h6-13,16-18,22,29H,2-5,14-15,19-20H2,1H3,(H,41,44) |
| InChIKey | DFUQSFDBTYUAIV-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.63 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|