C31H30F6N2O2 — CID 11307701
N-[[1-[6,6-bis(4-fluorophenyl)hexanoyl]pyrrolidin-3-yl]methyl]-3-fluoro-5-(trifluoromethyl)benzamide (PubChem CID 11307701) has the molecular formula C31H30F6N2O2 and a molecular weight of 576.58 g/mol. Its IUPAC name is N-[[1-[6,6-bis(4-fluorophenyl)hexanoyl]pyrrolidin-3-yl]methyl]-3-fluoro-5-(trifluoromethyl)benzamide.
| Compound Name | N-[[1-[6,6-bis(4-fluorophenyl)hexanoyl]pyrrolidin-3-yl]methyl]-3-fluoro-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 11307701 |
| Molecular Formula | C31H30F6N2O2 |
| Molecular Weight | 576.58 g/mol |
| Exact Mass | 576.22 |
| IUPAC Name | N-[[1-[6,6-bis(4-fluorophenyl)hexanoyl]pyrrolidin-3-yl]methyl]-3-fluoro-5-(trifluoromethyl)benzamide |
| SMILES | O=C(NCC1CCN(C(=O)CCCCC(c2ccc(F)cc2)c2ccc(F)cc2)C1)c1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C31H30F6N2O2/c32-25-9-5-21(6-10-25)28(22-7-11-26(33)12-8-22)3-1-2-4-29(40)39-14-13-20(19-39)18-38-30(41)23-15-24(31(35,36)37)17-27(34)16-23/h5-12,15-17,20,28H,1-4,13-14,18-19H2,(H,38,41) |
| InChIKey | PLIZMXZJDWJUBZ-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.58 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|