C18H23FN2O2 — CID 25479373
4-fluoro-N-[[(3R)-1-pent-4-enoylpiperidin-3-yl]methyl]benzamide (PubChem CID 25479373) has the molecular formula C18H23FN2O2 and a molecular weight of 318.39 g/mol. Its IUPAC name is 4-fluoro-N-[[(3R)-1-pent-4-enoylpiperidin-3-yl]methyl]benzamide.
| Compound Name | 4-fluoro-N-[[(3R)-1-pent-4-enoylpiperidin-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 25479373 |
| Molecular Formula | C18H23FN2O2 |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 4-fluoro-N-[[(3R)-1-pent-4-enoylpiperidin-3-yl]methyl]benzamide |
| SMILES | C=CCCC(=O)N1CCC[C@H](CNC(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C18H23FN2O2/c1-2-3-6-17(22)21-11-4-5-14(13-21)12-20-18(23)15-7-9-16(19)10-8-15/h2,7-10,14H,1,3-6,11-13H2,(H,20,23)/t14-/m1/s1 |
| InChIKey | MLZSUOQDOAMKMM-CQSZACIVSA-N |
| XLogP | 2.76 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|