C22H25FN2O4 — CID 24790363
N-[[1-(3,4-dimethoxybenzoyl)piperidin-3-yl]methyl]-4-fluorobenzamide (PubChem CID 24790363) has the molecular formula C22H25FN2O4 and a molecular weight of 400.45 g/mol. Its IUPAC name is N-[[1-(3,4-dimethoxybenzoyl)piperidin-3-yl]methyl]-4-fluorobenzamide.
| Compound Name | N-[[1-(3,4-dimethoxybenzoyl)piperidin-3-yl]methyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 24790363 |
| Molecular Formula | C22H25FN2O4 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | N-[[1-(3,4-dimethoxybenzoyl)piperidin-3-yl]methyl]-4-fluorobenzamide |
| SMILES | COc1ccc(C(=O)N2CCCC(CNC(=O)c3ccc(F)cc3)C2)cc1OC |
| InChI | InChI=1S/C22H25FN2O4/c1-28-19-10-7-17(12-20(19)29-2)22(27)25-11-3-4-15(14-25)13-24-21(26)16-5-8-18(23)9-6-16/h5-10,12,15H,3-4,11,13-14H2,1-2H3,(H,24,26) |
| InChIKey | RBEMYDNSGJKMDN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |