C20H22FN3O2 — CID 25481314
4-fluoro-N-[[(3R)-1-(6-methylpyridine-2-carbonyl)piperidin-3-yl]methyl]benzamide (PubChem CID 25481314) has the molecular formula C20H22FN3O2 and a molecular weight of 355.41 g/mol. Its IUPAC name is 4-fluoro-N-[[(3R)-1-(6-methylpyridine-2-carbonyl)piperidin-3-yl]methyl]benzamide.
| Compound Name | 4-fluoro-N-[[(3R)-1-(6-methylpyridine-2-carbonyl)piperidin-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 25481314 |
| Molecular Formula | C20H22FN3O2 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 4-fluoro-N-[[(3R)-1-(6-methylpyridine-2-carbonyl)piperidin-3-yl]methyl]benzamide |
| SMILES | Cc1cccc(C(=O)N2CCC[C@H](CNC(=O)c3ccc(F)cc3)C2)n1 |
| InChI | InChI=1S/C20H22FN3O2/c1-14-4-2-6-18(23-14)20(26)24-11-3-5-15(13-24)12-22-19(25)16-7-9-17(21)10-8-16/h2,4,6-10,15H,3,5,11-13H2,1H3,(H,22,25)/t15-/m1/s1 |
| InChIKey | PUIPVZIFVOPUKA-OAHLLOKOSA-N |
| XLogP | 2.81 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |