C17H23FN2O3 — CID 110903798
4-fluoro-N-[4-[3-(hydroxymethyl)piperidin-1-yl]-4-oxobutyl]benzamide (PubChem CID 110903798) has the molecular formula C17H23FN2O3 and a molecular weight of 322.38 g/mol. Its IUPAC name is 4-fluoro-N-[4-[3-(hydroxymethyl)piperidin-1-yl]-4-oxobutyl]benzamide.
| Compound Name | 4-fluoro-N-[4-[3-(hydroxymethyl)piperidin-1-yl]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 110903798 |
| Molecular Formula | C17H23FN2O3 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 4-fluoro-N-[4-[3-(hydroxymethyl)piperidin-1-yl]-4-oxobutyl]benzamide |
| SMILES | O=C(NCCCC(=O)N1CCCC(CO)C1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H23FN2O3/c18-15-7-5-14(6-8-15)17(23)19-9-1-4-16(22)20-10-2-3-13(11-20)12-21/h5-8,13,21H,1-4,9-12H2,(H,19,23) |
| InChIKey | FMWMETNESOIDNO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|