C38H48F2N2O3 — CID 11707131
N-[(E)-4-[6,6-bis(4-fluorophenyl)hexanoylamino]but-2-enyl]-3,5-ditert-butyl-4-methoxybenzamide (PubChem CID 11707131) has the molecular formula C38H48F2N2O3 and a molecular weight of 618.81 g/mol. Its IUPAC name is N-[(E)-4-[6,6-bis(4-fluorophenyl)hexanoylamino]but-2-enyl]-3,5-ditert-butyl-4-methoxybenzamide.
| Compound Name | N-[(E)-4-[6,6-bis(4-fluorophenyl)hexanoylamino]but-2-enyl]-3,5-ditert-butyl-4-methoxybenzamide |
|---|---|
| PubChem CID | 11707131 |
| Molecular Formula | C38H48F2N2O3 |
| Molecular Weight | 618.81 g/mol |
| Exact Mass | 618.36 |
| IUPAC Name | N-[(E)-4-[6,6-bis(4-fluorophenyl)hexanoylamino]but-2-enyl]-3,5-ditert-butyl-4-methoxybenzamide |
| SMILES | COc1c(C(C)(C)C)cc(C(=O)NC/C=C/CNC(=O)CCCCC(c2ccc(F)cc2)c2ccc(F)cc2)cc1C(C)(C)C |
| InChI | InChI=1S/C38H48F2N2O3/c1-37(2,3)32-24-28(25-33(35(32)45-7)38(4,5)6)36(44)42-23-11-10-22-41-34(43)13-9-8-12-31(26-14-18-29(39)19-15-26)27-16-20-30(40)21-17-27/h10-11,14-21,24-25,31H,8-9,12-13,22-23H2,1-7H3,(H,41,43)(H,42,44)/b11-10+ |
| InChIKey | KDVQHRNINBYVGU-ZHACJKMWSA-N |
| XLogP | 8.36 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.81 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|