About N-butanoyl-6,6-bis(4-fluorophenyl)-N-propylhexanamide
N-butanoyl-6,6-bis(4-fluorophenyl)-N-propylhexanamide (PubChem CID 142948838) has the molecular formula C25H31F2NO2
and a molecular weight of 415.52 g/mol. Its IUPAC name is N-butanoyl-6,6-bis(4-fluorophenyl)-N-propylhexanamide.
Molecular Properties
| Compound Name | N-butanoyl-6,6-bis(4-fluorophenyl)-N-propylhexanamide |
| PubChem CID | 142948838 |
| Molecular Formula | C25H31F2NO2 |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | N-butanoyl-6,6-bis(4-fluorophenyl)-N-propylhexanamide |
| SMILES | CCCC(=O)N(CCC)C(=O)CCCCC(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H31F2NO2/c1-3-7-24(29)28(18-4-2)25(30)9-6-5-8-23(19-10-14-21(26)15-11-19)20-12-16-22(27)17-13-20/h10-17,23H,3-9,18H2,1-2H3 |
| InChIKey | QMLJOUATKSNXCY-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butanoyl-6,6-bis(4-fluorophenyl)-N-propylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butanoyl-6,6-bis(4-fluorophenyl)-N-propylhexanamide?
The IUPAC name of N-butanoyl-6,6-bis(4-fluorophenyl)-N-propylhexanamide (CID 142948838) is N-butanoyl-6,6-bis(4-fluorophenyl)-N-propylhexanamide.
What is the SMILES notation for N-butanoyl-6,6-bis(4-fluorophenyl)-N-propylhexanamide?
The canonical SMILES for N-butanoyl-6,6-bis(4-fluorophenyl)-N-propylhexanamide is CCCC(=O)N(CCC)C(=O)CCCCC(c1ccc(F)cc1)c1ccc(F)cc1.
What is the InChIKey of N-butanoyl-6,6-bis(4-fluorophenyl)-N-propylhexanamide?
The InChIKey is QMLJOUATKSNXCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H31F2NO2/c1-3-7-24(29)28(18-4-2)25(30)9-6-5-8-23(19-10-14-21(26)15-11-19)20-12-16-22(27)17-13-20/h10-17,23H,3-9,18H2,1-2H3.
What are the key properties of N-butanoyl-6,6-bis(4-fluorophenyl)-N-propylhexanamide?
N-butanoyl-6,6-bis(4-fluorophenyl)-N-propylhexanamide has a molecular weight of 415.52 g/mol, XLogP of 6.22, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butanoyl-6,6-bis(4-fluorophenyl)-N-propylhexanamide is sourced from PubChem (CID 142948838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).