C16H24FNO — CID 110297678
4-(4-fluorophenyl)-N,N-dipropylbutanamide (PubChem CID 110297678) has the molecular formula C16H24FNO and a molecular weight of 265.37 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N,N-dipropylbutanamide.
| Compound Name | 4-(4-fluorophenyl)-N,N-dipropylbutanamide |
|---|---|
| PubChem CID | 110297678 |
| Molecular Formula | C16H24FNO |
| Molecular Weight | 265.37 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 4-(4-fluorophenyl)-N,N-dipropylbutanamide |
| SMILES | CCCN(CCC)C(=O)CCCc1ccc(F)cc1 |
| InChI | InChI=1S/C16H24FNO/c1-3-12-18(13-4-2)16(19)7-5-6-14-8-10-15(17)11-9-14/h8-11H,3-7,12-13H2,1-2H3 |
| InChIKey | CNJNHTSRBROTLU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.37 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |