C13H18FNO3 — CID 60682225
3-(4-fluorophenyl)-N,N-bis(2-hydroxyethyl)propanamide (PubChem CID 60682225) has the molecular formula C13H18FNO3 and a molecular weight of 255.29 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N,N-bis(2-hydroxyethyl)propanamide.
| Compound Name | 3-(4-fluorophenyl)-N,N-bis(2-hydroxyethyl)propanamide |
|---|---|
| PubChem CID | 60682225 |
| Molecular Formula | C13H18FNO3 |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 3-(4-fluorophenyl)-N,N-bis(2-hydroxyethyl)propanamide |
| SMILES | O=C(CCc1ccc(F)cc1)N(CCO)CCO |
| InChI | InChI=1S/C13H18FNO3/c14-12-4-1-11(2-5-12)3-6-13(18)15(7-9-16)8-10-17/h1-2,4-5,16-17H,3,6-10H2 |
| InChIKey | SHPTYEJDAVMGTD-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |