C14H16FNO5 — CID 82325169
3-[2-carboxyethyl-[2-(4-fluorophenyl)acetyl]amino]propanoic acid (PubChem CID 82325169) has the molecular formula C14H16FNO5 and a molecular weight of 297.28 g/mol. Its IUPAC name is 3-[2-carboxyethyl-[2-(4-fluorophenyl)acetyl]amino]propanoic acid.
| Compound Name | 3-[2-carboxyethyl-[2-(4-fluorophenyl)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 82325169 |
| Molecular Formula | C14H16FNO5 |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 3-[2-carboxyethyl-[2-(4-fluorophenyl)acetyl]amino]propanoic acid |
| SMILES | O=C(O)CCN(CCC(=O)O)C(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C14H16FNO5/c15-11-3-1-10(2-4-11)9-12(17)16(7-5-13(18)19)8-6-14(20)21/h1-4H,5-9H2,(H,18,19)(H,20,21) |
| InChIKey | CTKCIYHXDFFJQU-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |