C22H26O4 — CID 22642355
4-[1-(4-carboxyphenyl)octyl]benzoic acid (PubChem CID 22642355) has the molecular formula C22H26O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is 4-[1-(4-carboxyphenyl)octyl]benzoic acid.
| Compound Name | 4-[1-(4-carboxyphenyl)octyl]benzoic acid |
|---|---|
| PubChem CID | 22642355 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 4-[1-(4-carboxyphenyl)octyl]benzoic acid |
| SMILES | CCCCCCCC(c1ccc(C(=O)O)cc1)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C22H26O4/c1-2-3-4-5-6-7-20(16-8-12-18(13-9-16)21(23)24)17-10-14-19(15-11-17)22(25)26/h8-15,20H,2-7H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | WMZCGKFOAMTFDP-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|