About 4-aminobenzoic acid;(2R)-octan-2-ol
4-aminobenzoic acid;(2R)-octan-2-ol (PubChem CID 71443340) has the molecular formula C15H25NO3
and a molecular weight of 267.37 g/mol. Its IUPAC name is 4-aminobenzoic acid;(2R)-octan-2-ol.
Molecular Properties
| Compound Name | 4-aminobenzoic acid;(2R)-octan-2-ol |
| PubChem CID | 71443340 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 4-aminobenzoic acid;(2R)-octan-2-ol |
| SMILES | CCCCCC[C@@H](C)O.Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C8H18O.C7H7NO2/c1-3-4-5-6-7-8(2)9;8-6-3-1-5(2-4-6)7(9)10/h8-9H,3-7H2,1-2H3;1-4H,8H2,(H,9,10)/t8-;/m1./s1 |
| InChIKey | LJXDQZGQEXTVKB-DDWIOCJRSA-N |
| XLogP | 3.30 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-aminobenzoic acid;(2R)-octan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminobenzoic acid;(2R)-octan-2-ol?
The IUPAC name of 4-aminobenzoic acid;(2R)-octan-2-ol (CID 71443340) is 4-aminobenzoic acid;(2R)-octan-2-ol.
What is the SMILES notation for 4-aminobenzoic acid;(2R)-octan-2-ol?
The canonical SMILES for 4-aminobenzoic acid;(2R)-octan-2-ol is CCCCCC[C@@H](C)O.Nc1ccc(C(=O)O)cc1.
What is the InChIKey of 4-aminobenzoic acid;(2R)-octan-2-ol?
The InChIKey is LJXDQZGQEXTVKB-DDWIOCJRSA-N. The full InChI is InChI=1S/C8H18O.C7H7NO2/c1-3-4-5-6-7-8(2)9;8-6-3-1-5(2-4-6)7(9)10/h8-9H,3-7H2,1-2H3;1-4H,8H2,(H,9,10)/t8-;/m1./s1.
What are the key properties of 4-aminobenzoic acid;(2R)-octan-2-ol?
4-aminobenzoic acid;(2R)-octan-2-ol has a molecular weight of 267.37 g/mol, XLogP of 3.30, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobenzoic acid;(2R)-octan-2-ol is sourced from PubChem (CID 71443340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).