C21H39ClN2O3 — CID 21150227
4-aminobenzoic acid;1-(2,8-dimethylnonylamino)propan-2-ol;hydrochloride (PubChem CID 21150227) has the molecular formula C21H39ClN2O3 and a molecular weight of 403.01 g/mol. Its IUPAC name is 4-aminobenzoic acid;1-(2,8-dimethylnonylamino)propan-2-ol;hydrochloride.
| Compound Name | 4-aminobenzoic acid;1-(2,8-dimethylnonylamino)propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 21150227 |
| Molecular Formula | C21H39ClN2O3 |
| Molecular Weight | 403.01 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | 4-aminobenzoic acid;1-(2,8-dimethylnonylamino)propan-2-ol;hydrochloride |
| SMILES | CC(C)CCCCCC(C)CNCC(C)O.Cl.Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C14H31NO.C7H7NO2.ClH/c1-12(2)8-6-5-7-9-13(3)10-15-11-14(4)16;8-6-3-1-5(2-4-6)7(9)10;/h12-16H,5-11H2,1-4H3;1-4H,8H2,(H,9,10);1H |
| InChIKey | WXDBEZIZEFBPOX-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.01 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|