About 4-aminobenzoic acid;4-(dimethylamino)-3-methylbutan-2-ol;hydrochloride
4-aminobenzoic acid;4-(dimethylamino)-3-methylbutan-2-ol;hydrochloride (PubChem CID 23616993) has the molecular formula C14H25ClN2O3
and a molecular weight of 304.82 g/mol. Its IUPAC name is 4-aminobenzoic acid;4-(dimethylamino)-3-methylbutan-2-ol;hydrochloride.
Molecular Properties
| Compound Name | 4-aminobenzoic acid;4-(dimethylamino)-3-methylbutan-2-ol;hydrochloride |
| PubChem CID | 23616993 |
| Molecular Formula | C14H25ClN2O3 |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 4-aminobenzoic acid;4-(dimethylamino)-3-methylbutan-2-ol;hydrochloride |
| SMILES | CC(O)C(C)CN(C)C.Cl.Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C7H7NO2.C7H17NO.ClH/c8-6-3-1-5(2-4-6)7(9)10;1-6(7(2)9)5-8(3)4;/h1-4H,8H2,(H,9,10);6-7,9H,5H2,1-4H3;1H |
| InChIKey | XISHAHCWSGJSAU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-aminobenzoic acid;4-(dimethylamino)-3-methylbutan-2-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminobenzoic acid;4-(dimethylamino)-3-methylbutan-2-ol;hydrochloride?
The IUPAC name of 4-aminobenzoic acid;4-(dimethylamino)-3-methylbutan-2-ol;hydrochloride (CID 23616993) is 4-aminobenzoic acid;4-(dimethylamino)-3-methylbutan-2-ol;hydrochloride.
What is the SMILES notation for 4-aminobenzoic acid;4-(dimethylamino)-3-methylbutan-2-ol;hydrochloride?
The canonical SMILES for 4-aminobenzoic acid;4-(dimethylamino)-3-methylbutan-2-ol;hydrochloride is CC(O)C(C)CN(C)C.Cl.Nc1ccc(C(=O)O)cc1.
What is the InChIKey of 4-aminobenzoic acid;4-(dimethylamino)-3-methylbutan-2-ol;hydrochloride?
The InChIKey is XISHAHCWSGJSAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.C7H17NO.ClH/c8-6-3-1-5(2-4-6)7(9)10;1-6(7(2)9)5-8(3)4;/h1-4H,8H2,(H,9,10);6-7,9H,5H2,1-4H3;1H.
What are the key properties of 4-aminobenzoic acid;4-(dimethylamino)-3-methylbutan-2-ol;hydrochloride?
4-aminobenzoic acid;4-(dimethylamino)-3-methylbutan-2-ol;hydrochloride has a molecular weight of 304.82 g/mol, XLogP of 1.95, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobenzoic acid;4-(dimethylamino)-3-methylbutan-2-ol;hydrochloride is sourced from PubChem (CID 23616993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).