C14H31NO — CID 21150228
1-(2,8-dimethylnonylamino)propan-2-ol (PubChem CID 21150228) has the molecular formula C14H31NO and a molecular weight of 229.41 g/mol. Its IUPAC name is 1-(2,8-dimethylnonylamino)propan-2-ol.
| Compound Name | 1-(2,8-dimethylnonylamino)propan-2-ol |
|---|---|
| PubChem CID | 21150228 |
| Molecular Formula | C14H31NO |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.24 |
| IUPAC Name | 1-(2,8-dimethylnonylamino)propan-2-ol |
| SMILES | CC(C)CCCCCC(C)CNCC(C)O |
| InChI | InChI=1S/C14H31NO/c1-12(2)8-6-5-7-9-13(3)10-15-11-14(4)16/h12-16H,5-11H2,1-4H3 |
| InChIKey | PNUBSMPIKOMMEP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|