C20H24N2O2 — CID 172726729
1,3-bis(4-aminophenyl)-2-pentylpropane-1,3-dione (PubChem CID 172726729) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is 1,3-bis(4-aminophenyl)-2-pentylpropane-1,3-dione.
| Compound Name | 1,3-bis(4-aminophenyl)-2-pentylpropane-1,3-dione |
|---|---|
| PubChem CID | 172726729 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 1,3-bis(4-aminophenyl)-2-pentylpropane-1,3-dione |
| SMILES | CCCCCC(C(=O)c1ccc(N)cc1)C(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C20H24N2O2/c1-2-3-4-5-18(19(23)14-6-10-16(21)11-7-14)20(24)15-8-12-17(22)13-9-15/h6-13,18H,2-5,21-22H2,1H3 |
| InChIKey | HGBMPPJRUBSIGI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|