About 2-benzoyldodecanamide
2-benzoyldodecanamide (PubChem CID 87280750) has the molecular formula C19H29NO2
and a molecular weight of 303.45 g/mol. Its IUPAC name is 2-benzoyldodecanamide.
Molecular Properties
| Compound Name | 2-benzoyldodecanamide |
| PubChem CID | 87280750 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | 2-benzoyldodecanamide |
| SMILES | CCCCCCCCCCC(C(N)=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C19H29NO2/c1-2-3-4-5-6-7-8-12-15-17(19(20)22)18(21)16-13-10-9-11-14-16/h9-11,13-14,17H,2-8,12,15H2,1H3,(H2,20,22) |
| InChIKey | PAAXWFXVCZZLEU-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-benzoyldodecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzoyldodecanamide?
The IUPAC name of 2-benzoyldodecanamide (CID 87280750) is 2-benzoyldodecanamide.
What is the SMILES notation for 2-benzoyldodecanamide?
The canonical SMILES for 2-benzoyldodecanamide is CCCCCCCCCCC(C(N)=O)C(=O)c1ccccc1.
What is the InChIKey of 2-benzoyldodecanamide?
The InChIKey is PAAXWFXVCZZLEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29NO2/c1-2-3-4-5-6-7-8-12-15-17(19(20)22)18(21)16-13-10-9-11-14-16/h9-11,13-14,17H,2-8,12,15H2,1H3,(H2,20,22).
What are the key properties of 2-benzoyldodecanamide?
2-benzoyldodecanamide has a molecular weight of 303.45 g/mol, XLogP of 4.50, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzoyldodecanamide is sourced from PubChem (CID 87280750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).