About N-benzoylbenzohydrazide;2-nonylpropanedioic acid
N-benzoylbenzohydrazide;2-nonylpropanedioic acid (PubChem CID 175262903) has the molecular formula C26H34N2O6
and a molecular weight of 470.57 g/mol. Its IUPAC name is N-benzoylbenzohydrazide;2-nonylpropanedioic acid.
Molecular Properties
| Compound Name | N-benzoylbenzohydrazide;2-nonylpropanedioic acid |
| PubChem CID | 175262903 |
| Molecular Formula | C26H34N2O6 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | N-benzoylbenzohydrazide;2-nonylpropanedioic acid |
| SMILES | CCCCCCCCCC(C(=O)O)C(=O)O.NN(C(=O)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C14H12N2O2.C12H22O4/c15-16(13(17)11-7-3-1-4-8-11)14(18)12-9-5-2-6-10-12;1-2-3-4-5-6-7-8-9-10(11(13)14)12(15)16/h1-10H,15H2;10H,2-9H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | FWQGNFVOKFGBAL-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 138.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-benzoylbenzohydrazide;2-nonylpropanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzoylbenzohydrazide;2-nonylpropanedioic acid?
The IUPAC name of N-benzoylbenzohydrazide;2-nonylpropanedioic acid (CID 175262903) is N-benzoylbenzohydrazide;2-nonylpropanedioic acid.
What is the SMILES notation for N-benzoylbenzohydrazide;2-nonylpropanedioic acid?
The canonical SMILES for N-benzoylbenzohydrazide;2-nonylpropanedioic acid is CCCCCCCCCC(C(=O)O)C(=O)O.NN(C(=O)c1ccccc1)C(=O)c1ccccc1.
What is the InChIKey of N-benzoylbenzohydrazide;2-nonylpropanedioic acid?
The InChIKey is FWQGNFVOKFGBAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O2.C12H22O4/c15-16(13(17)11-7-3-1-4-8-11)14(18)12-9-5-2-6-10-12;1-2-3-4-5-6-7-8-9-10(11(13)14)12(15)16/h1-10H,15H2;10H,2-9H2,1H3,(H,13,14)(H,15,16).
What are the key properties of N-benzoylbenzohydrazide;2-nonylpropanedioic acid?
N-benzoylbenzohydrazide;2-nonylpropanedioic acid has a molecular weight of 470.57 g/mol, XLogP of 4.76, 12 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzoylbenzohydrazide;2-nonylpropanedioic acid is sourced from PubChem (CID 175262903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).