C17H29N3O — CID 174528291
N-(3,4-diaminodecyl)benzamide (PubChem CID 174528291) has the molecular formula C17H29N3O and a molecular weight of 291.44 g/mol. Its IUPAC name is N-(3,4-diaminodecyl)benzamide.
| Compound Name | N-(3,4-diaminodecyl)benzamide |
|---|---|
| PubChem CID | 174528291 |
| Molecular Formula | C17H29N3O |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.23 |
| IUPAC Name | N-(3,4-diaminodecyl)benzamide |
| SMILES | CCCCCCC(N)C(N)CCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H29N3O/c1-2-3-4-8-11-15(18)16(19)12-13-20-17(21)14-9-6-5-7-10-14/h5-7,9-10,15-16H,2-4,8,11-13,18-19H2,1H3,(H,20,21) |
| InChIKey | XDLKBVKADNSVIX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|