About 1H-azepine;N-pentylbenzamide
1H-azepine;N-pentylbenzamide (PubChem CID 175240845) has the molecular formula C18H24N2O
and a molecular weight of 284.40 g/mol. Its IUPAC name is 1H-azepine;N-pentylbenzamide.
Molecular Properties
| Compound Name | 1H-azepine;N-pentylbenzamide |
| PubChem CID | 175240845 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 1H-azepine;N-pentylbenzamide |
| SMILES | C1=CC=CNC=C1.CCCCCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H17NO.C6H7N/c1-2-3-7-10-13-12(14)11-8-5-4-6-9-11;1-2-4-6-7-5-3-1/h4-6,8-9H,2-3,7,10H2,1H3,(H,13,14);1-7H |
| InChIKey | DUUOPYSNJVKRHF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1H-azepine;N-pentylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-azepine;N-pentylbenzamide?
The IUPAC name of 1H-azepine;N-pentylbenzamide (CID 175240845) is 1H-azepine;N-pentylbenzamide.
What is the SMILES notation for 1H-azepine;N-pentylbenzamide?
The canonical SMILES for 1H-azepine;N-pentylbenzamide is C1=CC=CNC=C1.CCCCCNC(=O)c1ccccc1.
What is the InChIKey of 1H-azepine;N-pentylbenzamide?
The InChIKey is DUUOPYSNJVKRHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO.C6H7N/c1-2-3-7-10-13-12(14)11-8-5-4-6-9-11;1-2-4-6-7-5-3-1/h4-6,8-9H,2-3,7,10H2,1H3,(H,13,14);1-7H.
What are the key properties of 1H-azepine;N-pentylbenzamide?
1H-azepine;N-pentylbenzamide has a molecular weight of 284.40 g/mol, XLogP of 3.78, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-azepine;N-pentylbenzamide is sourced from PubChem (CID 175240845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).