C27H38O2 — CID 67568318
4-[1-(4-heptylphenyl)heptyl]benzoic acid (PubChem CID 67568318) has the molecular formula C27H38O2 and a molecular weight of 394.60 g/mol. Its IUPAC name is 4-[1-(4-heptylphenyl)heptyl]benzoic acid.
| Compound Name | 4-[1-(4-heptylphenyl)heptyl]benzoic acid |
|---|---|
| PubChem CID | 67568318 |
| Molecular Formula | C27H38O2 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.29 |
| IUPAC Name | 4-[1-(4-heptylphenyl)heptyl]benzoic acid |
| SMILES | CCCCCCCc1ccc(C(CCCCCC)c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C27H38O2/c1-3-5-7-9-10-12-22-14-16-23(17-15-22)26(13-11-8-6-4-2)24-18-20-25(21-19-24)27(28)29/h14-21,26H,3-13H2,1-2H3,(H,28,29) |
| InChIKey | CFRJTAQIUZRZRX-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|