C22H28FNO4 — CID 55751531
N-[1-(4-fluorophenyl)-3,3-dimethylbutyl]-3,4,5-trimethoxybenzamide (PubChem CID 55751531) has the molecular formula C22H28FNO4 and a molecular weight of 389.47 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)-3,3-dimethylbutyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[1-(4-fluorophenyl)-3,3-dimethylbutyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 55751531 |
| Molecular Formula | C22H28FNO4 |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | N-[1-(4-fluorophenyl)-3,3-dimethylbutyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NC(CC(C)(C)C)c2ccc(F)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C22H28FNO4/c1-22(2,3)13-17(14-7-9-16(23)10-8-14)24-21(25)15-11-18(26-4)20(28-6)19(12-15)27-5/h7-12,17H,13H2,1-6H3,(H,24,25) |
| InChIKey | NNRXZSVBDFDGSN-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |