C41H52F2N2O5 — CID 11707403
ethyl (2S,4S)-4-[6,6-bis(4-fluorophenyl)hexanoylamino]-1-(3,5-ditert-butyl-4-methoxybenzoyl)pyrrolidine-2-carboxylate (PubChem CID 11707403) has the molecular formula C41H52F2N2O5 and a molecular weight of 690.87 g/mol. Its IUPAC name is ethyl (2S,4S)-4-[6,6-bis(4-fluorophenyl)hexanoylamino]-1-(3,5-ditert-butyl-4-methoxybenzoyl)pyrrolidine-2-carboxylate.
| Compound Name | ethyl (2S,4S)-4-[6,6-bis(4-fluorophenyl)hexanoylamino]-1-(3,5-ditert-butyl-4-methoxybenzoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 11707403 |
| Molecular Formula | C41H52F2N2O5 |
| Molecular Weight | 690.87 g/mol |
| Exact Mass | 690.38 |
| IUPAC Name | ethyl (2S,4S)-4-[6,6-bis(4-fluorophenyl)hexanoylamino]-1-(3,5-ditert-butyl-4-methoxybenzoyl)pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@H](NC(=O)CCCCC(c2ccc(F)cc2)c2ccc(F)cc2)CN1C(=O)c1cc(C(C)(C)C)c(OC)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C41H52F2N2O5/c1-9-50-39(48)35-24-31(25-45(35)38(47)28-22-33(40(2,3)4)37(49-8)34(23-28)41(5,6)7)44-36(46)13-11-10-12-32(26-14-18-29(42)19-15-26)27-16-20-30(43)21-17-27/h14-23,31-32,35H,9-13,24-25H2,1-8H3,(H,44,46)/t31-,35-/m0/s1 |
| InChIKey | HHJZWOFADIURDH-ZJJOJAIXSA-N |
| XLogP | 8.22 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.87 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|