C27H32N2O9 — CID 141116158
methyl (2S,4S)-4-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]-1-(3,4,5-trimethoxybenzoyl)pyrrolidine-2-carboxylate (PubChem CID 141116158) has the molecular formula C27H32N2O9 and a molecular weight of 528.56 g/mol. Its IUPAC name is methyl (2S,4S)-4-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]-1-(3,4,5-trimethoxybenzoyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4S)-4-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]-1-(3,4,5-trimethoxybenzoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 141116158 |
| Molecular Formula | C27H32N2O9 |
| Molecular Weight | 528.56 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | methyl (2S,4S)-4-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]-1-(3,4,5-trimethoxybenzoyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](NC(=O)/C=C/c2ccc(OC)c(OC)c2)CN1C(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C27H32N2O9/c1-33-20-9-7-16(11-21(20)34-2)8-10-24(30)28-18-14-19(27(32)38-6)29(15-18)26(31)17-12-22(35-3)25(37-5)23(13-17)36-4/h7-13,18-19H,14-15H2,1-6H3,(H,28,30)/b10-8+/t18-,19-/m0/s1 |
| InChIKey | SPECHLXDFPBAIJ-FQPQFXKESA-N |
| XLogP | 2.32 |
| TPSA | 121.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.56 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|