C26H30N2O6 — CID 141075521
methyl (2S,4S)-1-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-4-(3-phenylpropanoylamino)pyrrolidine-2-carboxylate (PubChem CID 141075521) has the molecular formula C26H30N2O6 and a molecular weight of 466.53 g/mol. Its IUPAC name is methyl (2S,4S)-1-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-4-(3-phenylpropanoylamino)pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4S)-1-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-4-(3-phenylpropanoylamino)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 141075521 |
| Molecular Formula | C26H30N2O6 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | methyl (2S,4S)-1-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-4-(3-phenylpropanoylamino)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](NC(=O)CCc2ccccc2)CN1C(=O)/C=C/c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C26H30N2O6/c1-32-22-12-9-19(15-23(22)33-2)11-14-25(30)28-17-20(16-21(28)26(31)34-3)27-24(29)13-10-18-7-5-4-6-8-18/h4-9,11-12,14-15,20-21H,10,13,16-17H2,1-3H3,(H,27,29)/b14-11+/t20-,21-/m0/s1 |
| InChIKey | DVOZVCWVVSTYMY-SAAUVRMOSA-N |
| XLogP | 2.61 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|