C25H29N3O6 — CID 25147252
(2S,4S)-1-[3-(3,4-dimethoxyphenyl)propanoyl]-N-hydroxy-4-[[(E)-3-phenylprop-2-enoyl]amino]pyrrolidine-2-carboxamide (PubChem CID 25147252) has the molecular formula C25H29N3O6 and a molecular weight of 467.52 g/mol. Its IUPAC name is (2S,4S)-1-[3-(3,4-dimethoxyphenyl)propanoyl]-N-hydroxy-4-[[(E)-3-phenylprop-2-enoyl]amino]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-1-[3-(3,4-dimethoxyphenyl)propanoyl]-N-hydroxy-4-[[(E)-3-phenylprop-2-enoyl]amino]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 25147252 |
| Molecular Formula | C25H29N3O6 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | (2S,4S)-1-[3-(3,4-dimethoxyphenyl)propanoyl]-N-hydroxy-4-[[(E)-3-phenylprop-2-enoyl]amino]pyrrolidine-2-carboxamide |
| SMILES | COc1ccc(CCC(=O)N2C[C@@H](NC(=O)/C=C/c3ccccc3)C[C@H]2C(=O)NO)cc1OC |
| InChI | InChI=1S/C25H29N3O6/c1-33-21-11-8-18(14-22(21)34-2)10-13-24(30)28-16-19(15-20(28)25(31)27-32)26-23(29)12-9-17-6-4-3-5-7-17/h3-9,11-12,14,19-20,32H,10,13,15-16H2,1-2H3,(H,26,29)(H,27,31)/b12-9+/t19-,20-/m0/s1 |
| InChIKey | XOPFIARROALHID-UNERYHBUSA-N |
| XLogP | 1.94 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|