C24H28N2O5 — CID 71960595
[3-[3-(3,4-dimethoxyphenyl)prop-2-enoylamino]cyclohexyl] N-phenylcarbamate (PubChem CID 71960595) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is [3-[3-(3,4-dimethoxyphenyl)prop-2-enoylamino]cyclohexyl] N-phenylcarbamate.
| Compound Name | [3-[3-(3,4-dimethoxyphenyl)prop-2-enoylamino]cyclohexyl] N-phenylcarbamate |
|---|---|
| PubChem CID | 71960595 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | [3-[3-(3,4-dimethoxyphenyl)prop-2-enoylamino]cyclohexyl] N-phenylcarbamate |
| SMILES | COc1ccc(C=CC(=O)NC2CCCC(OC(=O)Nc3ccccc3)C2)cc1OC |
| InChI | InChI=1S/C24H28N2O5/c1-29-21-13-11-17(15-22(21)30-2)12-14-23(27)25-19-9-6-10-20(16-19)31-24(28)26-18-7-4-3-5-8-18/h3-5,7-8,11-15,19-20H,6,9-10,16H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | UQTLIIINQCIVTQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|