C25H31NO5 — CID 55745702
(E)-N-[1-(4-cyclopentyloxy-3-methoxyphenyl)ethyl]-3-(3,4-dimethoxyphenyl)prop-2-enamide (PubChem CID 55745702) has the molecular formula C25H31NO5 and a molecular weight of 425.53 g/mol. Its IUPAC name is (E)-N-[1-(4-cyclopentyloxy-3-methoxyphenyl)ethyl]-3-(3,4-dimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[1-(4-cyclopentyloxy-3-methoxyphenyl)ethyl]-3-(3,4-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 55745702 |
| Molecular Formula | C25H31NO5 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | (E)-N-[1-(4-cyclopentyloxy-3-methoxyphenyl)ethyl]-3-(3,4-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NC(C)c2ccc(OC3CCCC3)c(OC)c2)cc1OC |
| InChI | InChI=1S/C25H31NO5/c1-17(19-11-13-22(24(16-19)30-4)31-20-7-5-6-8-20)26-25(27)14-10-18-9-12-21(28-2)23(15-18)29-3/h9-17,20H,5-8H2,1-4H3,(H,26,27)/b14-10+ |
| InChIKey | ABUJENXMUPWUAC-GXDHUFHOSA-N |
| XLogP | 4.92 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|