C24H26N2O3S — CID 55781211
(E)-3-(1,3-benzothiazol-2-yl)-N-[1-(4-cyclopentyloxy-3-methoxyphenyl)ethyl]prop-2-enamide (PubChem CID 55781211) has the molecular formula C24H26N2O3S and a molecular weight of 422.55 g/mol. Its IUPAC name is (E)-3-(1,3-benzothiazol-2-yl)-N-[1-(4-cyclopentyloxy-3-methoxyphenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzothiazol-2-yl)-N-[1-(4-cyclopentyloxy-3-methoxyphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 55781211 |
| Molecular Formula | C24H26N2O3S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | (E)-3-(1,3-benzothiazol-2-yl)-N-[1-(4-cyclopentyloxy-3-methoxyphenyl)ethyl]prop-2-enamide |
| SMILES | COc1cc(C(C)NC(=O)/C=C/c2nc3ccccc3s2)ccc1OC1CCCC1 |
| InChI | InChI=1S/C24H26N2O3S/c1-16(17-11-12-20(21(15-17)28-2)29-18-7-3-4-8-18)25-23(27)13-14-24-26-19-9-5-6-10-22(19)30-24/h5-6,9-16,18H,3-4,7-8H2,1-2H3,(H,25,27)/b14-13+ |
| InChIKey | HJNKAPKWTOEZNC-BUHFOSPRSA-N |
| XLogP | 5.52 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|