C20H26N2O6 — CID 141060751
methyl 1-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-4-(propanoylamino)pyrrolidine-2-carboxylate (PubChem CID 141060751) has the molecular formula C20H26N2O6 and a molecular weight of 390.44 g/mol. Its IUPAC name is methyl 1-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-4-(propanoylamino)pyrrolidine-2-carboxylate.
| Compound Name | methyl 1-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-4-(propanoylamino)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 141060751 |
| Molecular Formula | C20H26N2O6 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | methyl 1-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-4-(propanoylamino)pyrrolidine-2-carboxylate |
| SMILES | CCC(=O)NC1CC(C(=O)OC)N(C(=O)/C=C/c2ccc(OC)c(OC)c2)C1 |
| InChI | InChI=1S/C20H26N2O6/c1-5-18(23)21-14-11-15(20(25)28-4)22(12-14)19(24)9-7-13-6-8-16(26-2)17(10-13)27-3/h6-10,14-15H,5,11-12H2,1-4H3,(H,21,23)/b9-7+ |
| InChIKey | IOMHIXDCOYLLAG-VQHVLOKHSA-N |
| XLogP | 1.39 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|