C23H25N3O6 — CID 25147249
methyl (2S,4S)-1-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-4-(pyridine-3-carbonylamino)pyrrolidine-2-carboxylate (PubChem CID 25147249) has the molecular formula C23H25N3O6 and a molecular weight of 439.47 g/mol. Its IUPAC name is methyl (2S,4S)-1-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-4-(pyridine-3-carbonylamino)pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4S)-1-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-4-(pyridine-3-carbonylamino)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 25147249 |
| Molecular Formula | C23H25N3O6 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | methyl (2S,4S)-1-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-4-(pyridine-3-carbonylamino)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](NC(=O)c2cccnc2)CN1C(=O)/C=C/c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C23H25N3O6/c1-30-19-8-6-15(11-20(19)31-2)7-9-21(27)26-14-17(12-18(26)23(29)32-3)25-22(28)16-5-4-10-24-13-16/h4-11,13,17-18H,12,14H2,1-3H3,(H,25,28)/b9-7+/t17-,18-/m0/s1 |
| InChIKey | KTJDKDVTYIKQCS-AZGCOUAMSA-N |
| XLogP | 1.68 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|