C18H23NO8S — CID 25147156
methyl (2S,4R)-1-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-4-methylsulfonyloxypyrrolidine-2-carboxylate (PubChem CID 25147156) has the molecular formula C18H23NO8S and a molecular weight of 413.45 g/mol. Its IUPAC name is methyl (2S,4R)-1-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-4-methylsulfonyloxypyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4R)-1-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-4-methylsulfonyloxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 25147156 |
| Molecular Formula | C18H23NO8S |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | methyl (2S,4R)-1-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-4-methylsulfonyloxypyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H](OS(C)(=O)=O)CN1C(=O)/C=C/c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C18H23NO8S/c1-24-15-7-5-12(9-16(15)25-2)6-8-17(20)19-11-13(27-28(4,22)23)10-14(19)18(21)26-3/h5-9,13-14H,10-11H2,1-4H3/b8-6+/t13-,14+/m1/s1 |
| InChIKey | MOFHEJYRFDDJMD-RNUUNTDPSA-N |
| XLogP | 0.84 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|